Organotin chalcogenide salts: synthesis, characterization, and extended crystal structures.

Reactions of Cl(3)SnR(1)H with Na(2)E (E = Se, Te; R(1) = C(2)H(4)COO) in liquid ammonia afforded the salts of an anionic defect heterocubane, [(RSn)(3)Se(4)](-) (R = R(1) and R(1)H) or an (infinity)(1)[(R(1)Sn)(2)Te(3)(2-)] anionic polymer, respectively. Although a reaction using a 1:1.5 ratio of Cl(3)SnR(1)H:Na(2)S.(9)H(2)O in acetone/water produced a compound containing [(R(1)Sn)(3)S(4)](2-), a 1:2 ratio leads to the formation of (infinity)(1)[(R(1)Sn)(2)S(3)(2-)], isostructural to the homologous Te species.